For research use only. Not for therapeutic Use.
N-(2-Hydroxyethyl)piperazine-N’-(2-ethane sulfonic acid)（Cat No.:I010716）, commonly known as HEPES, is a highly versatile buffer widely used in biological research. It belongs to the class of Good’s buffers and exhibits zwitterionic properties, making it effective in maintaining a stable pH within the range of 6.0 to 8.5. HEPES has exceptionally strong buffer capacity under physiological pH conditions, which makes it suitable for a variety of applications, including cell culture, enzyme assays, and molecular biology techniques. Its stability, compatibility, and reliable buffering capability make HEPES a preferred choice in many biological experiments.
| Catalog Number | I010716 |
| CAS Number | 75277-39-3 |
| Synonyms | 4-(2-Hydroxyethyl)piperazine-1-ethanesulfonic acid sodium salt |
| Molecular Formula | C8H17N2NaO4S |
| Purity | ≥95% |
| Target | Reagents |
| Storage | Store at RT |
| IUPAC Name | sodium;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonate |
| InChI | InChI=1S/C8H18N2O4S.Na/c11-7-5-9-1-3-10(4-2-9)6-8-15(12,13)14;/h11H,1-8H2,(H,12,13,14);/q;+1/p-1 |
| InChIKey | RDZTWEVXRGYCFV-UHFFFAOYSA-M |
| SMILES | C1CN(CCN1CCO)CCS(=O)(=O)[O-].[Na+] |
