For research use only. Not for therapeutic Use.
Heptadecan-9-yl 8-bromooctanoate(Cat No.:I043636)is a synthetic chemical compound that combines a long-chain alkyl group, heptadecan-9-yl, with an 8-bromooctanoate ester. This molecule is primarily used in research to explore its potential applications in drug delivery systems, as its structure allows for interactions with lipid membranes and biological systems. The presence of the bromine atom in the structure may offer opportunities for modifying the compound’s reactivity, enabling its use in various chemical and biochemical studies. It is also investigated for potential antimicrobial or anticancer properties.
CAS Number | 2089253-22-3 |
Synonyms | heptadecan-9-yl 8-bromooctanoate |
Molecular Formula | C25H49BrO2 |
Purity | ≥95% |
IUPAC Name | heptadecan-9-yl 8-bromooctanoate |
InChI | InChI=1S/C25H49BrO2/c1-3-5-7-9-12-16-20-24(21-17-13-10-8-6-4-2)28-25(27)22-18-14-11-15-19-23-26/h24H,3-23H2,1-2H3 |
InChIKey | KHEPAYMMEKWSAW-UHFFFAOYSA-N |
SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCBr |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |