For research use only. Not for therapeutic Use.
Heptamidine Dimethanesulfonate(CAT: I015583) is a potent inhibitor of Trypanosoma brucei, the causative agent of African trypanosomiasis. By targeting the parasite’s mitochondrial function and DNA replication, it disrupts its life cycle, offering valuable insights into anti-parasitic mechanisms. This compound is particularly relevant in the field of anti-infection research, supporting studies aimed at developing therapies for parasitic diseases. With its high specificity and efficacy, Heptamidine Dimethanesulfonate serves as a crucial tool for advancing research into trypanosomal infections and exploring novel therapeutic strategies to combat neglected tropical diseases.
| Catalog Number | I015583 |
| CAS Number | 161374-55-6 |
| Molecular Formula | C₂₃H₃₆N₄O₈S₂ |
| Purity | ≥95% |
| IUPAC Name | 4-[7-(4-carbamimidoylphenoxy)heptoxy]benzenecarboximidamide;methanesulfonic acid |
| InChI | InChI=1S/C21H28N4O2.2CH4O3S/c22-20(23)16-6-10-18(11-7-16)26-14-4-2-1-3-5-15-27-19-12-8-17(9-13-19)21(24)25;2*1-5(2,3)4/h6-13H,1-5,14-15H2,(H3,22,23)(H3,24,25);2*1H3,(H,2,3,4) |
| InChIKey | VJPVVWMWVOBCIC-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.C1=CC(=CC=C1C(=N)N)OCCCCCCCOC2=CC=C(C=C2)C(=N)N |
