For research use only. Not for therapeutic Use.
Heptyl hexanoate (Cat.No:L003759) is an important chemical compound widely used in the fragrance and flavor industry. Its distinct ester profile imparts a fruity, apple-like aroma and taste. This compound is a key ingredient in various food and cosmetic products. Its pleasant fragrance and flavor attributes make it a valuable component in the formulation of consumer goods, highlighting its significance in the creation of sensory experiences in everyday products.
| Catalog Number | L003759 |
| CAS Number | 6976-72-3 |
| Molecular Formula | C13H26O2 |
| Purity | ≥95% |
| IUPAC Name | heptyl hexanoate |
| InChI | InChI=1S/C13H26O2/c1-3-5-7-8-10-12-15-13(14)11-9-6-4-2/h3-12H2,1-2H3 |
| InChIKey | QEKCBKVWQYEUGY-UHFFFAOYSA-N |
| SMILES | CCCCCCCOC(=O)CCCCC |
