For research use only. Not for therapeutic Use.
Heraclenol（Cat No.:R003876）is a naturally occurring coumarin compound found in certain plant species, particularly in the Apiaceae family. Known for its potential therapeutic properties, Heraclenol is being studied for its anti-inflammatory, antioxidant, and antimicrobial effects. In traditional and herbal medicine, compounds like Heraclenol have been explored for their potential in alleviating various health issues related to inflammation and infection. Its biochemical structure supports interactions with cellular pathways associated with oxidative stress, making it a valuable compound in research focused on natural remedies and pharmacological applications.
| Catalog Number | R003876 |
| CAS Number | 31575-93-6 |
| Molecular Formula | C16H16O6 |
| Purity | ≥95% |
| Target | Bacterial |
| IUPAC Name | 9-[(2R)-2,3-dihydroxy-3-methylbutoxy]furo[3,2-g]chromen-7-one |
| InChI | InChI=1S/C16H16O6/c1-16(2,19)11(17)8-21-15-13-10(5-6-20-13)7-9-3-4-12(18)22-14(9)15/h3-7,11,17,19H,8H2,1-2H3/t11-/m1/s1 |
| InChIKey | FOINLJRVEBYARJ-LLVKDONJSA-N |
| SMILES | CC(C)(C(COC1=C2C(=CC3=C1OC=C3)C=CC(=O)O2)O)O |
