For research use only. Not for therapeutic Use.
Herbacetin 3,8-O-diglucoside (Herbacetin di-glucoside) is a flavonol compound that can be found in flax seeds[1].
| Catalog Number | I040430 |
| CAS Number | 99224-12-1 |
| Synonyms | 5,7-dihydroxy-2-(4-hydroxyphenyl)-3,8-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]chromen-4-one |
| Molecular Formula | C27H30O17 |
| Purity | ≥95% |
| InChI | InChI=1S/C27H30O17/c28-6-12-15(33)18(36)20(38)26(40-12)43-23-11(32)5-10(31)14-17(35)25(22(42-24(14)23)8-1-3-9(30)4-2-8)44-27-21(39)19(37)16(34)13(7-29)41-27/h1-5,12-13,15-16,18-21,26-34,36-39H,6-7H2/t12-,13-,15-,16-,18+,19+,20-,21-,26+,27+/m1/s1 |
| InChIKey | VMOKZQAQPBUNRW-PXJYGDGDSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C(=O)C3=C(O2)C(=C(C=C3O)O)OC4C(C(C(C(O4)CO)O)O)O)OC5C(C(C(C(O5)CO)O)O)O)O |
| Reference | [1]. Corbin C, et, al. Development and validation of an efficient ultrasound assisted extraction of phenolic compounds from flax (Linum usitatissimum L.) seeds. Ultrason Sonochem. 2015 Sep:26:176-185. |
