For research use only. Not for therapeutic Use.
Herbacetin(CAT: R066200) is a naturally occurring flavonoid found in various plants, known for its potent antioxidant and anti-inflammatory properties. This bioactive compound has been extensively studied for its ability to inhibit key enzymes involved in inflammation and oxidative stress, making it a valuable tool in pharmacological research. Herbacetin has shown potential in cancer research, particularly in inhibiting tumor cell proliferation and inducing apoptosis in certain cancer cell lines. Additionally, it has been investigated for its protective effects against cardiovascular diseases and its role in modulating metabolic pathways. Its versatility and efficacy make Herbacetin a significant compound in the study of natural product-based therapeutics.
| Catalog Number | R066200 |
| CAS Number | 527-95-7 |
| Synonyms | Isoarticulatidin;8-hydroxy Kaempferol;3,5,7,8,4/’-Pentahydroxyflavone |
| Molecular Formula | C15H10O7 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| Storage | -20°C |
| IUPAC Name | 3,5,7,8-tetrahydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| InChI | InChI=1S/C15H10O7/c16-7-3-1-6(2-4-7)14-13(21)12(20)10-8(17)5-9(18)11(19)15(10)22-14/h1-5,16-19,21H |
| InChIKey | ZDOTZEDNGNPOEW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C(=O)C3=C(O2)C(=C(C=C3O)O)O)O)O |
