For research use only. Not for therapeutic Use.
Hexacosanoic Acid-d4 (CAT: C000503) is a deuterated form of hexacosanoic acid, which is a long-chain saturated fatty acid containing 26 carbon atoms. The “d4” designation indicates that four hydrogen atoms in the molecule have been replaced with deuterium atoms, which are heavier isotopes of hydrogen. This labeling is commonly used in analytical chemistry and spectroscopy, such as nuclear magnetic resonance (NMR) spectroscopy, to study the structure and properties of organic compounds.
CAS Number | 1194984-85-4 |
Synonyms | Cerotic Acid-d4; Ceratinic Acid-d4; Ceric Acid-d4; Cerinic Acid-d4; Cerylic Acid-d4; NSC 4205-d4; n-Hexacosanoic Acid-d4; Hexacosanoic-12,12,13,13-d4 Acid |
Molecular Formula | C₂₆H₄₈D₄O₂ |
Purity | ≥95% |
Target | Endogenous Metabolite |
Solubility | Chloroform Sparingly), Hexanes (Slightly), Methanol (Slightly) |
Appearance | White to Off-White Solid |
Storage | 4°C |
IUPAC Name | 12,12,13,13-tetradeuteriohexacosanoic acid |
InChI | InChI=1S/C26H52O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26(27)28/h2-25H2,1H3,(H,27,28)/i14D2,15D2 |
InChIKey | XMHIUKTWLZUKEX-QZPARXMSSA-N |
SMILES | [2H]C([2H])(CCCCCCCCCCCCC)C([2H])([2H])CCCCCCCCCCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |