For research use only. Not for therapeutic Use.
Hexacosanoic acid, also known as cerotic acid, is a long-chain saturated fatty acid with a 26-carbon backbone. This straight-chain fatty acid is characterized by its waxy texture and low solubility in water. It occurs naturally in various plant and animal fats, particularly in beeswax and some seed oils. Hexacosanoic acid has applications in the cosmetic and food industries, often used as a thickening agent or emollient. Additionally, it may serve as a precursor in the synthesis of bioactive compounds and surfactants.
CAS Number | 506-46-7 |
Synonyms | hexacosanoic acid |
Molecular Formula | C26H52O2 |
Purity | ≥95% |
InChI | InChI=1S/C26H52O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26(27)28/h2-25H2,1H3,(H,27,28) |
InChIKey | XMHIUKTWLZUKEX-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCCCCCCCCCCCCCCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |