For research use only, not for therapeutic use.
Hexaflumuron (Cat. No: R016894) is a chitin synthesis inhibitor, used as a kind of insecticide in fruit trees, vegetables, cotton, and other crops to control a variety of Lepidoptera pests.
| Catalog Number | R016894 |
| CAS Number | 86479-06-3 |
| Synonyms | Hexafluron; OMS 3031; Sonet; XRD 473; AI 3-29832; Consult; Consult 100EC; Cosult; N-[[[3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]amino]carbonyl]-2,6-difluorobenzamide |
| Molecular Formula | C16H8Cl2F6N2O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | N-[[3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]carbamoyl]-2,6-difluorobenzamide |
| InChI | InChI=1S/C16H8Cl2F6N2O3/c17-7-4-6(5-8(18)12(7)29-16(23,24)14(21)22)25-15(28)26-13(27)11-9(19)2-1-3-10(11)20/h1-5,14H,(H2,25,26,27,28) |
| InChIKey | RGNPBRKPHBKNKX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)NC(=O)NC2=CC(=C(C(=C2)Cl)OC(C(F)F)(F)F)Cl)F |
