For research use only. Not for therapeutic Use.
Hexafluorocyclotriphosphazene(Cat No.:M079067), is a chemical compound composed of alternating nitrogen and phosphorus atoms bonded in a ring-like structure. It is often referred to as “hexaphosphazene” and belongs to the class of compounds known as phosphazenes. Hexafluorocyclotriphosphazene is valued for its high thermal stability, nonflammability, and resistance to chemical reactions, making it useful in various applications. It serves as a precursor in the synthesis of organophosphorus compounds, flame retardants, and polymers with specialized properties, including high-temperature resistance and electrical conductivity. Its unique structure and properties contribute to advancements in materials science, particularly in the development of advanced polymers and specialty chemicals.
CAS Number | 15599-91-4 |
Molecular Formula | F6N3P3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,2,4,4,6,6-hexafluoro-1,3,5-triaza-2$l^{5} |
InChI | InChI=1S/F6N3P3/c1-10(2)7-11(3,4)9-12(5,6)8-10 |
InChIKey | DKQPXAWBVGCNHG-UHFFFAOYSA-N |
SMILES | N1=P(N=P(N=P1(F)F)(F)F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |