For research use only. Not for therapeutic Use.
Hexamethylcyclotrisiloxane (Cat No.:R064329), also known as 2,2,4,4,6,6-Hexamethylcyclotrisiloxane, Dimethylsiloxane Cyclic Trimer, LS 8120, SDK 10, is used in the manufacture of methyl vinyl Silicone rubber products, in addition to being used to synthesize general silicone polymers, can also be used to prepare specific silicone compounds, as various surface treatment agents, coupling agents, cross-linking agents, etc.
| Catalog Number | R064329 |
| CAS Number | 541-05-9 |
| Synonyms | 2,2,4,4,6,6-Hexamethylcyclotrisiloxane; Dimethylsiloxane Cyclic Trimer; LS 8120; SDK 10 |
| Molecular Formula | C6H18O3Si3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,2,4,4,6,6-hexamethyl-1,3,5,2,4,6-trioxatrisilinane |
| InChI | InChI=1S/C6H18O3Si3/c1-10(2)7-11(3,4)9-12(5,6)8-10/h1-6H3 |
| InChIKey | HTDJPCNNEPUOOQ-UHFFFAOYSA-N |
| SMILES | C[Si]1(O[Si](O[Si](O1)(C)C)(C)C)C |
