For research use only. Not for therapeutic Use.
Hexanal-d12 is a fully deuterated analog of hexanal, where all 12 hydrogen atoms are replaced with deuterium. This isotopically labeled compound is particularly valuable in research focused on lipid oxidation, flavor chemistry, and the study of aldehyde behavior in various chemical and biological processes. The deuterium labeling enhances the stability of the compound and allows for precise tracking and analysis using mass spectrometry and NMR spectroscopy. Hexanal-d12 is commonly used in studies investigating the formation and degradation of aldehydes, especially in food science, where hexanal is a key marker for lipid oxidation. It provides reliable data for understanding the mechanisms of oxidative processes and for the development of methods to control or mitigate aldehyde formation in various applications.
CAS Number | 1219803-74-3 |
Synonyms | Caproaldehyde-d12; Caproic Aldehyde-d12; Capronaldehyde-d12; Hexaldehyde-d12; Hexanaldehyde-d12; Hexylaldehyde-d12; NSC 2596-d12; n-Caproaldehyde-d12; n-Capronaldehyde-d12; n-Hexanal-d12; n-Hexylaldehyde-d12; |
Molecular Formula | C6H12O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6,6-dodecadeuteriohexan-1-one |
InChI | InChI=1S/C6H12O/c1-2-3-4-5-6-7/h6H,2-5H2,1H3/i1D3,2D2,3D2,4D2,5D2,6D |
InChIKey | JARKCYVAAOWBJS-PSDCQUMKSA-N |
SMILES | [2H]C(=O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |