For research use only. Not for therapeutic Use.
Hexaphthalic acid (Cat.No:L003336) is a pivotal chemical compound in materials science. Its distinct molecular structure makes it a valuable precursor for the synthesis of specialized polymers, highlighting its significance in the development of advanced materials for various industries.
CAS Number | 1246015-46-2 |
Molecular Formula | C38H26O4 |
Purity | ≥95% |
IUPAC Name | 4-[4-[4-[4-[4-(4-carboxyphenyl)phenyl]phenyl]phenyl]phenyl]benzoic acid |
InChI | InChI=1S/C38H26O4/c39-37(40)35-21-17-33(18-22-35)31-13-9-29(10-14-31)27-5-1-25(2-6-27)26-3-7-28(8-4-26)30-11-15-32(16-12-30)34-19-23-36(24-20-34)38(41)42/h1-24H,(H,39,40)(H,41,42) |
InChIKey | WZYFHDBTDJEEAC-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)C3=CC=C(C=C3)C4=CC=C(C=C4)C(=O)O)C5=CC=C(C=C5)C6=CC=C(C=C6)C(=O)O |