For research use only. Not for therapeutic Use.
Hexidium Iodide is a membrane-permeant fluorescent dye widely used in microbiology for the selective staining of gram-positive bacteria. This cationic dye binds to the nucleic acids of cells, emitting a bright fluorescence that allows for easy differentiation between gram-positive and gram-negative bacteria in mixed populations. Hexidium Iodide is particularly valuable in flow cytometry, fluorescence microscopy, and other imaging techniques, providing a reliable method for bacterial identification and analysis in both clinical and research settings.
| Catalog Number | R072036 |
| CAS Number | 211566-66-4 |
| Molecular Formula | C25H28IN3 |
| Purity | ≥95% |
| Target | DNA Stain |
| IUPAC Name | 5-hexyl-6-phenylphenanthridin-5-ium-3,8-diamine;iodide |
| InChI | InChI=1S/C25H27N3.HI/c1-2-3-4-8-15-28-24-17-20(27)12-14-22(24)21-13-11-19(26)16-23(21)25(28)18-9-6-5-7-10-18;/h5-7,9-14,16-17,27H,2-4,8,15,26H2,1H3;1H |
| InChIKey | DBMJYWPMRSOUGB-UHFFFAOYSA-N |
| SMILES | CCCCCC[N+]1=C2C=C(C=CC2=C3C=CC(=CC3=C1C4=CC=CC=C4)N)N.[I-] |
