For research use only. Not for therapeutic Use.
Hexyl 2-methoxyacetate (Cat.No:L003681) is a significant chemical compound with diverse industrial applications. This ester, derived from methoxyacetic acid, finds use in various formulations, such as in coatings, solvents, and fragrances. Its unique chemical structure imparts specific properties crucial for these applications. Hexyl 2-methoxyacetate serves as a valuable component in the production of specialized materials.
Catalog Number | L003681 |
CAS Number | 145747-16-6 |
Molecular Formula | C9H18O3 |
Purity | ≥95% |
IUPAC Name | hexyl 2-methoxyacetate |
InChI | InChI=1S/C9H18O3/c1-3-4-5-6-7-12-9(10)8-11-2/h3-8H2,1-2H3 |
InChIKey | QJGFFKKLJRHCMV-UHFFFAOYSA-N |
SMILES | CCCCCCOC(=O)COC |