For research use only. Not for therapeutic Use.
Hexyldiphenylphosphine(Cat No.:M080625)is a high-purity organophosphorus compound commonly used in pharmaceutical, chemical, and materials research. This molecule features a hexyl group and two phenyl groups bonded to a phosphorus atom, making it a versatile ligand in coordination chemistry and catalysis. Its structure allows for selective reactivity, particularly in the formation of metal complexes, which are valuable in catalytic processes, including cross-coupling reactions. Hexyldiphenylphosphine is essential for precise synthetic applications, contributing to advancements in organometallic chemistry and the development of novel catalytic systems.
CAS Number | 18298-00-5 |
Molecular Formula | C18H23P |
Purity | ≥95% |
IUPAC Name | hexyl(diphenyl)phosphane |
InChI | InChI=1S/C18H23P/c1-2-3-4-11-16-19(17-12-7-5-8-13-17)18-14-9-6-10-15-18/h5-10,12-15H,2-4,11,16H2,1H3 |
InChIKey | WHNGQRQJGDUZPJ-UHFFFAOYSA-N |
SMILES | CCCCCCP(C1=CC=CC=C1)C2=CC=CC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |