For research use only. Not for therapeutic Use.
Hexylresorcinol (Cat No.:I001417) is an organic compound widely used in pharmaceuticals and personal care products. It possesses antiseptic, local anaesthetic, and anthelmintic properties. Notably, it acts as a potent inhibitor of mushroom tyrosinase, causing a substantial 90% loss of enzyme activity at a concentration of 100 μM. This makes hexylresorcinol valuable in skin-lightening and depigmentation treatments. With its versatile properties, hexylresorcinol finds applications in various industries, including medicine, cosmetics, and agriculture.
| Catalog Number | I001417 |
| CAS Number | 136-77-6 |
| Synonyms | 4-hexylbenzene-1,3-diol |
| Molecular Formula | C12H18O2 |
| Purity | ≥95% |
| Target | Tyrosinases |
| Solubility | DMSO: ≥ 1.8 mg/mL |
| Storage | 2-8°C |
| IUPAC Name | 4-hexylbenzene-1,3-diol |
| InChI | InChI=1S/C12H18O2/c1-2-3-4-5-6-10-7-8-11(13)9-12(10)14/h7-9,13-14H,2-6H2,1H3 |
| InChIKey | WFJIVOKAWHGMBH-UHFFFAOYSA-N |
| SMILES | CCCCCCC1=C(C=C(C=C1)O)O |
| Reference | <p style=/line-height:25px/> |
