For research use only. Not for therapeutic Use.
HIF1-IN-3（Cat No.:I043537）is a selective inhibitor of hypoxia-inducible factor 1 (HIF-1), a transcription factor that plays a crucial role in cellular responses to low oxygen conditions, such as those found in tumors. HIF-1 regulates the expression of genes involved in angiogenesis, metabolism, and cell survival, which are critical for cancer progression. By inhibiting HIF-1, HIF1-IN-3 aims to disrupt these adaptive mechanisms, potentially limiting tumor growth and metastasis. It is being explored as a therapeutic agent for targeting hypoxia-driven cancers and other diseases associated with aberrant HIF-1 activity.
| CAS Number | 333314-79-7 |
| Synonyms | N-[(8-hydroxyquinolin-7-yl)-(4-methoxyphenyl)methyl]-3-phenylpropanamide |
| Molecular Formula | C26H24N2O3 |
| Purity | ≥95% |
| IUPAC Name | N-[(8-hydroxyquinolin-7-yl)-(4-methoxyphenyl)methyl]-3-phenylpropanamide |
| InChI | InChI=1S/C26H24N2O3/c1-31-21-13-10-20(11-14-21)24(28-23(29)16-9-18-6-3-2-4-7-18)22-15-12-19-8-5-17-27-25(19)26(22)30/h2-8,10-15,17,24,30H,9,16H2,1H3,(H,28,29) |
| InChIKey | RFCCQJJHFAITGH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C2=C(C3=C(C=CC=N3)C=C2)O)NC(=O)CCC4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
