For research use only. Not for therapeutic Use.
Hinesol (Cat No.:R023989 ) is a natural compound found in the essential oil of Hymenaea courbaril, a tree native to tropical regions. It is known for its antioxidant, anti-inflammatory, and antimicrobial properties. Hinesol has shown potential in various studies for modulating cellular pathways involved in inflammation and oxidative stress, making it a candidate for treating conditions such as arthritis, infections, and skin disorders. Ongoing research is exploring its broader therapeutic applications, including its use in cosmetics and alternative medicine.
CAS Number | 23811-08-7 |
Synonyms | (2R,5S,10S)-α,α,6,10-Tetramethyl-spiro[4.5]dec-6-ene-2-methanol;?Hinesol; [2R-[2α,5α(S*)]]-α,α,6,10-Tetramethyl-spiro[4.5]dec-6-ene-2-methanol; (-)-Hinesol |
Molecular Formula | C₁₅H₂₆O |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | 2-[(3R,5S,6S)-6,10-dimethylspiro[4.5]dec-9-en-3-yl]propan-2-ol |
InChI | 1S/C15H26O/c1-11-6-5-7-12(2)15(11)9-8-13(10-15)14(3,4)16/h6,12-13,16H,5,7-10H2,1-4H3/t12-,13+,15+/m0/s1 |
InChIKey | ICWHTQRTTHCUHW-GZBFAFLISA-N |
SMILES | C[C@H]1CCC=C([C@]12CC[C@H](C2)C(C)(C)O)C |