For research use only. Not for therapeutic Use.
Hinokinin (Compound 1) is a compound isolated from the stems of Hypoestes aristate. Hinokinin exhibits moderate activity of HIV-1 protease enzyme[1].
| Catalog Number | I043640 |
| CAS Number | 26543-89-5 |
| Synonyms | (3R,4R)-3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-one |
| Molecular Formula | C20H18O6 |
| Purity | ≥95% |
| InChI | InChI=1S/C20H18O6/c21-20-15(6-13-2-4-17-19(8-13)26-11-24-17)14(9-22-20)5-12-1-3-16-18(7-12)25-10-23-16/h1-4,7-8,14-15H,5-6,9-11H2/t14-,15+/m0/s1 |
| InChIKey | DDWGQGZPYDSYEL-LSDHHAIUSA-N |
| SMILES | C1C(C(C(=O)O1)CC2=CC3=C(C=C2)OCO3)CC4=CC5=C(C=C4)OCO5 |
| Reference | [1]. Ramabulana T, et al. Bioactive Lignans from Hypoestes aristata. J Nat Prod. 2020;83(8):2483-2489. |
