For research use only. Not for therapeutic Use.
Hinokinin（Cat No.:I043640）is a naturally occurring compound found in several plant species, including those in the genus Cinnamomum. It belongs to a class of molecules known as lignans and has been studied for its potential pharmacological properties. Hinokinin has demonstrated antioxidant, anti-inflammatory, and anticancer activities in preclinical studies. It is believed to exert its effects by modulating various signaling pathways, including those involved in oxidative stress and cell proliferation. Due to its promising bioactivity, hinokinin is being explored for its potential therapeutic applications in cancer treatment and other diseases associated with inflammation and oxidative damage.
| CAS Number | 26543-89-5 |
| Synonyms | (3R,4R)-3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-one |
| Molecular Formula | C20H18O6 |
| Purity | ≥95% |
| IUPAC Name | (3R,4R)-3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-one |
| InChI | InChI=1S/C20H18O6/c21-20-15(6-13-2-4-17-19(8-13)26-11-24-17)14(9-22-20)5-12-1-3-16-18(7-12)25-10-23-16/h1-4,7-8,14-15H,5-6,9-11H2/t14-,15+/m0/s1 |
| InChIKey | DDWGQGZPYDSYEL-LSDHHAIUSA-N |
| SMILES | C1[C@@H]([C@H](C(=O)O1)CC2=CC3=C(C=C2)OCO3)CC4=CC5=C(C=C4)OCO5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
