For research use only. Not for therapeutic Use.
Hippeastrine HBr is the hydrobromide salt form of hippeastrine, an alkaloid extracted from plants of the Amaryllidaceae family. It is known for its diverse biological activities, including antiviral, anticancer, and anticholinesterase effects. Hippeastrine HBr has been studied for its potential in treating neurodegenerative diseases, such as Alzheimer’s, due to its ability to inhibit cholinesterase enzymes. Additionally, its anticancer properties make it a candidate for cancer research, where it is explored for its ability to induce apoptosis in tumor cells.
Catalog Number | T000068 |
CAS Number | 22352-41-6 |
Synonyms | (5S,5aR,12bS,12cR)-5-Hydroxy-1-methyl-2,3,5,5a,12b,12c-hexahydro[1,3]dioxolo[6,7]isochromeno[3,4-g]indol-7(1H)-one, Hydrobromide |
Molecular Formula | C17H17NO5 |
Purity | ≥95% |
Solubility | In water |
Storage | Store at +4°C |
IUPAC Name | (2S,3S,9S,10S)-9-hydroxy-4-methyl-11,16,18-trioxa-4-azapentacyclo[11.7.0.02,10.03,7.015,19]icosa-1(20),7,13,15(19)-tetraen-12-one |
InChI | InChI=1S/C17H17NO5/c1-18-3-2-8-4-11(19)16-14(15(8)18)9-5-12-13(22-7-21-12)6-10(9)17(20)23-16/h4-6,11,14-16,19H,2-3,7H2,1H3/t11-,14-,15+,16+/m0/s1 |
InChIKey | DGQPIOQRPAGNGB-DANNLKNASA-N |
SMILES | CN1CCC2=CC(C3C(C21)C4=CC5=C(C=C4C(=O)O3)OCO5)O |