For research use only. Not for therapeutic Use.
Hircinoic Acid（Cat No.:R035821）, is a naturally occurring carboxylic acid found in certain plant species. It is a member of the triterpenoid family of compounds and is derived from various plant sources, including the roots of licorice (Glycyrrhiza glabra). Hircinoic acid is known for its potential anti-inflammatory and anti-tumor properties and has been studied for its therapeutic applications.
| Catalog Number | R035821 |
| CAS Number | 54947-74-9 |
| Synonyms | 4-Methyloctanoic Acid; 4-Methylcaprylic Acid; |
| Molecular Formula | C9H18O2 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| Storage | Room Temperature |
| IUPAC Name | 4-methyloctanoic acid |
| InChI | InChI=1S/C9H18O2/c1-3-4-5-8(2)6-7-9(10)11/h8H,3-7H2,1-2H3,(H,10,11) |
| InChIKey | LEGGANXCVQPIAI-UHFFFAOYSA-N |
| SMILES | CCCCC(C)CCC(=O)O |
