For research use only. Not for therapeutic Use.
Hirsutine(CAT: R072534) is an alkaloid compound that is naturally found in Uncaria rhynchophylla, a plant used in traditional Chinese medicine. Hirsutine has attracted scientific interest for its potential pharmacological properties. It has been studied for its cardiovascular effects, including its potential to lower blood pressure and improve circulation. Hirsutine’s vasodilatory and antiplatelet activities suggest potential applications in cardiovascular health. Additionally, hirsutine has been explored for its neuroprotective properties and its potential to enhance cognitive function, making it a subject of interest in neurological research.
| Catalog Number | R072534 |
| CAS Number | 7729-23-9 |
| Molecular Formula | C22H28N2O3 |
| Purity | ≥95% |
| Target | Apoptosis |
| IUPAC Name | methyl (E)-2-[(2S,3R,12bR)-3-ethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate |
| InChI | InChI=1S/C22H28N2O3/c1-4-14-12-24-10-9-16-15-7-5-6-8-19(15)23-21(16)20(24)11-17(14)18(13-26-2)22(25)27-3/h5-8,13-14,17,20,23H,4,9-12H2,1-3H3/b18-13+/t14-,17-,20+/m0/s1 |
| InChIKey | NMLUOJBSAYAYEM-AZQGJTAVSA-N |
| SMILES | CCC1CN2CCC3=C(C2CC1C(=COC)C(=O)OC)NC4=CC=CC=C34 |
