For research use only. Not for therapeutic Use.
His-Asp(Cat No.:L007016), also known as histidyl aspartic acid, is a dipeptide consisting of the amino acids histidine (His) and aspartic acid (Asp). Its chemical structure is C9H12N4O4. This dipeptide plays a crucial role in biochemical processes, contributing to enzyme catalysis, signal transduction, and protein-protein interactions. Histidine is an essential amino acid involved in various biological functions, while aspartic acid is a key component of protein synthesis and neurotransmitter activity.
CAS Number | 41658-60-0 |
Molecular Formula | C10H14N4O5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2S)-2-[[(2S)-2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid |
InChI | InChI=1S/C10H14N4O5/c11-6(1-5-3-12-4-13-5)9(17)14-7(10(18)19)2-8(15)16/h3-4,6-7H,1-2,11H2,(H,12,13)(H,14,17)(H,15,16)(H,18,19)/t6-,7-/m0/s1 |
InChIKey | MDCTVRUPVLZSPG-BQBZGAKWSA-N |
SMILES | C1=C(NC=N1)CC(C(=O)NC(CC(=O)O)C(=O)O)N |