For research use only. Not for therapeutic Use.
Hispidin (CAT: I011746) is a natural phenolic compound that can be found in various fungi and plants. It is known for its antioxidant, anti-inflammatory, and anticancer properties. Hispidin has been studied for its potential therapeutic effects, such as inhibiting tumor growth and promoting wound healing. It has also been shown to have neuroprotective effects and may be beneficial in the treatment of neurodegenerative diseases like Alzheimer’s and Parkinson’s. Hispidin is commonly extracted from mushrooms, such as Inonotus hispidus, and is used in traditional medicine practices in many countries.
| Catalog Number | I011746 |
| CAS Number | 555-55-5 |
| Synonyms | 6-[(1E)-2-(3,4-dihydroxyphenyl)ethenyl]-4-hydroxy-2H-pyran-2-one |
| Molecular Formula | C13H10O5 |
| Purity | ≥95% |
| Target | TGF-beta/Smad |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 6-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-4-hydroxypyran-2-one |
| InChI | InChI=1S/C13H10O5/c14-9-6-10(18-13(17)7-9)3-1-8-2-4-11(15)12(16)5-8/h1-7,14-16H/b3-1+ |
| InChIKey | SGJNQVTUYXCBKH-HNQUOIGGSA-N |
| SMILES | C1=CC(=C(C=C1C=CC2=CC(=CC(=O)O2)O)O)O |
