For research use only. Not for therapeutic Use.
Histamine H4 receptor antagonist-1 is an antagonist of histamine H4 receptor extracted from patent WO2010108059A1 compound 60[1].
| Catalog Number | I045180 |
| CAS Number | 1246207-84-0 |
| Synonyms | 7-[2-amino-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-N-[(2S)-1-(dimethylamino)-1-oxo-3-phenylpropan-2-yl]-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| Molecular Formula | C30H38N8O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C30H38N8O2/c1-35(2)28(39)26(17-21-7-5-4-6-8-21)33-30(40)38-12-11-22-9-10-23(18-24(22)20-38)25-19-27(34-29(31)32-25)37-15-13-36(3)14-16-37/h4-10,18-19,26H,11-17,20H2,1-3H3,(H,33,40)(H2,31,32,34)/t26-/m0/s1 |
| InChIKey | AVTPLFSHOMCNRC-SANMLTNESA-N |
| SMILES | CN1CCN(CC1)C2=NC(=NC(=C2)C3=CC4=C(CCN(C4)C(=O)NC(CC5=CC=CC=C5)C(=O)N(C)C)C=C3)N |
| Reference | [1]. Zhou J, et, al. Substituted pyrimidine derivatives as antagonists of the histamine h4 receptor. WO2010108059A1. |
