For research use only. Not for therapeutic Use.
HIV-1 inhibitor-6（Cat No.:I043583）is a small molecule compound being studied for its potential to inhibit the replication of human immunodeficiency virus type 1 (HIV-1). This inhibitor targets key proteins or enzymes involved in the HIV replication cycle, such as reverse transcriptase, integrase, or protease, thereby preventing the virus from replicating and infecting healthy cells. By blocking these essential viral processes, HIV-1 inhibitor-6 aims to reduce viral load and improve patient outcomes. It is being investigated as a potential addition to existing antiretroviral therapies, contributing to more effective management of HIV infection.
| CAS Number | 1821309-39-0 |
| Synonyms | 1-methyl-N-(5-nitro-1,2-benzothiazol-3-yl)-4-oxopyridine-3-carboxamide |
| Molecular Formula | C14H10N4O4S |
| Purity | ≥95% |
| IUPAC Name | 1-methyl-N-(5-nitro-1,2-benzothiazol-3-yl)-4-oxopyridine-3-carboxamide |
| InChI | InChI=1S/C14H10N4O4S/c1-17-5-4-11(19)10(7-17)14(20)15-13-9-6-8(18(21)22)2-3-12(9)23-16-13/h2-7H,1H3,(H,15,16,20) |
| InChIKey | CPKUAABJFWRBSN-UHFFFAOYSA-N |
| SMILES | CN1C=CC(=O)C(=C1)C(=O)NC2=NSC3=C2C=C(C=C3)[N+](=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
