For research use only. Not for therapeutic Use.
HIV-1 integrase inhibitors are a class of drugs used in the treatment of HIV infection. They target the viral integrase enzyme, which is responsible for integrating the viral DNA into the host cell’s genome. By inhibiting this enzyme, HIV-1 integrase inhibitors prevent the virus from replicating and spreading. These drugs are often used in combination with other antiretroviral therapies to control viral replication and reduce the risk of developing drug-resistant strains of HIV.
| Catalog Number | I005681 |
| CAS Number | 957890-42-5 |
| Synonyms | 2-(6-chloro-2-methyl-4-phenylquinolin-3-yl)pentanoic acid |
| Molecular Formula | C21H20ClNO2 |
| Purity | ≥95% |
| Target | HIV Protease |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 2-(6-chloro-2-methyl-4-phenylquinolin-3-yl)pentanoic acid |
| InChI | InChI=1S/C21H20ClNO2/c1-3-7-16(21(24)25)19-13(2)23-18-11-10-15(22)12-17(18)20(19)14-8-5-4-6-9-14/h4-6,8-12,16H,3,7H2,1-2H3,(H,24,25) |
| InChIKey | XRPUJSGGRFQZPJ-UHFFFAOYSA-N |
| SMILES | CCCC(C1=C(N=C2C=CC(=CC2=C1C3=CC=CC=C3)Cl)C)C(=O)O |
