For research use only. Not for therapeutic Use.
HLY78 is a potent small molecule inhibitor of the protein kinase CK2, a critical regulator in various cellular processes, including cell proliferation, apoptosis, and differentiation. By targeting CK2, HLY78 disrupts key signaling pathways involved in cancer progression, inflammation, and other diseases. This selective inhibition offers potential therapeutic applications in oncology and inflammatory conditions. Its ability to modulate kinase activity makes HLY78 a valuable tool for exploring CK2’s role in disease mechanisms and developing targeted therapies.
| Catalog Number | I011840 |
| CAS Number | 854847-61-3 |
| Synonyms | 4-ethyl-5,6-dihydro-5-methyl-[1,3]-dioxolo[4,5-j] phenanthridine |
| Molecular Formula | C17H17NO2 |
| Purity | ≥95% |
| Target | Wnt/β-catenin |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 4-ethyl-5-methyl-6H-[1,3]dioxolo[4,5-j]phenanthridine |
| InChI | InChI=1S/C17H17NO2/c1-3-11-5-4-6-13-14-8-16-15(19-10-20-16)7-12(14)9-18(2)17(11)13/h4-8H,3,9-10H2,1-2H3 |
| InChIKey | FAZZYPIBZBGQSH-UHFFFAOYSA-N |
| SMILES | CCC1=CC=CC2=C1N(CC3=CC4=C(C=C32)OCO4)C |
