For research use only. Not for therapeutic Use.
HM03 (NSC130813) (Cat.No:I012573) is a small molecule inhibitor with potential antitumor activity. It selectively targets the PI3K/Akt/mTOR signaling pathway, which plays a crucial role in cell growth and survival. HM03 inhibits the activity of PI3K, leading to the suppression of downstream signaling and tumor cell proliferation. It is being investigated for its therapeutic potential in cancer treatment.
| Catalog Number | I012573 |
| CAS Number | 500565-15-1 |
| Synonyms | NSC-130813; 4-[(6-Chloro-2-methoxyacridin-9-yl)amino]-2-[(4-methylpiperazin-1-yl)methyl]phenol |
| Molecular Formula | C26H27ClN4O2 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| IUPAC Name | 4-[(6-chloro-2-methoxyacridin-9-yl)amino]-2-[(4-methylpiperazin-1-yl)methyl]phenol |
| InChI | InChI=1S/C26H27ClN4O2/c1-30-9-11-31(12-10-30)16-17-13-19(4-8-25(17)32)28-26-21-6-3-18(27)14-24(21)29-23-7-5-20(33-2)15-22(23)26/h3-8,13-15,32H,9-12,16H2,1-2H3,(H,28,29) |
| InChIKey | SUSDGTMJKOGWSZ-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2=C(C=CC(=C2)NC3=C4C=C(C=CC4=NC5=C3C=CC(=C5)Cl)OC)O |
