For research use only. Not for therapeutic Use.
HMMNI-d3(Cat No.:S000425) is a deuterated form of HMMNI (hexamethylene mononitramine), where three hydrogen atoms are replaced with deuterium. This chemical is primarily used in research settings to study the properties and stability of HMMNI, which is a component of various energetic materials and explosives. The introduction of deuterium can significantly alter the compound’s thermal and chemical stability, making it an excellent subject for safety and decomposition studies. HMMNI-d3 provides valuable insights into the behavior of hexamethylene mononitramine under different conditions, aiding in the development of safer and more effective energetic materials.
CAS Number | 1015855-78-3 |
Molecular Formula | C5H4D3N3O3 |
Purity | ≥95% |
Target | Drug Metabolite |
IUPAC Name | [5-nitro-1-(trideuteriomethyl)imidazol-2-yl]methanol |
InChI | InChI=1S/C5H7N3O3/c1-7-4(3-9)6-2-5(7)8(10)11/h2,9H,3H2,1H3/i1D3 |
InChIKey | JSAQDPJIVQMBAY-FIBGUPNXSA-N |
SMILES | CN1C(=CN=C1CO)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |