For research use only. Not for therapeutic Use.
HMN-154(CAT: I013394) is a novel benzenesulfonamide compound that has shown potential as an anticancer agent. It has been found to inhibit the growth of KB cells (human cervical cancer cells) and colon38 cells (colon cancer cells) in preclinical studies. HMN-154 likely exerts its anticancer effects through specific mechanisms that affect cell proliferation, survival, or other processes crucial for tumor growth. Further research is needed to fully understand its mode of action and its potential as a therapeutic agent in cancer treatment.
CAS Number | 173528-92-2 |
Molecular Formula | C₂₀H₁₈N₂O₃S |
Purity | ≥95% |
Target | Others |
Solubility | DMSO: ≥15 mg/mL |
IUPAC Name | 4-methoxy-N-[2-[(E)-2-pyridin-4-ylethenyl]phenyl]benzenesulfonamide |
InChI | InChI=1S/C20H18N2O3S/c1-25-18-8-10-19(11-9-18)26(23,24)22-20-5-3-2-4-17(20)7-6-16-12-14-21-15-13-16/h2-15,22H,1H3/b7-6+ |
InChIKey | CIJCDFMGZYKSSC-VOTSOKGWSA-N |
SMILES | COC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2C=CC3=CC=NC=C3 |
Reference | [1]. Tanaka H, et al. Isolation of cDNAs encoding cellular drug-binding proteins using a novel expression cloning procedure: drug-western. Mol Pharmacol. 1999 Feb;55(2):356-63. |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |