For research use only. Not for therapeutic Use.
Hoechst 33258 analog 2(CAT: I002781) is a blue fluorescent dye commonly used to stain DNA. These dyes bind to the minor groove of double-stranded DNA, with a preference for AT-rich sequences. They can be used to stain DNA in live or fixed cells and are often referred to as supravital stains since cells can survive their treatment. Hoechst dyes are cell-permeable and can be actively transported out of the cytoplasm by specific ATP-binding cassette transporter proteins in some cells.
CAS Number | 23491-54-5 |
Synonyms | 6-(4-methylpiperazin-1-yl)-2/’-(m-tolyl)-1H,3/’H-2,5/’-bibenzo[d]imidazole |
Molecular Formula | C26H26N6 |
Purity | ≥95% |
Target | DNA Stain |
Solubility | 25℃: DMSO or water Protect from light |
Storage | Store at -20°C |
IUPAC Name | 2-(3-methylphenyl)-6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazole |
InChI | InChI=1S/C26H26N6/c1-17-4-3-5-18(14-17)25-27-21-8-6-19(15-23(21)29-25)26-28-22-9-7-20(16-24(22)30-26)32-12-10-31(2)11-13-32/h3-9,14-16H,10-13H2,1-2H3,(H,27,29)(H,28,30) |
InChIKey | QGOKBFIFCYHFRH-UHFFFAOYSA-N |
SMILES | CC1=CC(=CC=C1)C2=NC3=C(N2)C=C(C=C3)C4=NC5=C(N4)C=C(C=C5)N6CCN(CC6)C |
Reference | <p style=/line-height:25px/> <br>[2]. a b c /Hoechst Stains/. Invitrogren (Molecular Probes). <br>[3]. Portugal J, Waring MJ. Assignment of DNA binding sites for 4/’,6-diamidine-2-phenylindole and bisbenzimide (Hoechst 33258). A comparative footprinting study. Biochimica et Biophysica Acta 949 (2): 158-68. </p> |