For research use only. Not for therapeutic Use.
Hoffer’s Chlorosugar(CAT: L015239) is a specialized carbohydrate derivative featuring a chloro-substitution on its sugar backbone, commonly used as a synthetic intermediate in carbohydrate chemistry. It is an essential building block for the synthesis of glycosides, nucleosides, and other bioactive compounds. Due to its reactive chlorine group, it enables selective functionalization, facilitating the creation of structurally diverse molecules. Hoffer’s Chlorosugar plays a significant role in pharmaceutical research, particularly in the development of antiviral agents and glycoconjugates. With high purity and chemical versatility, it is a valuable reagent for researchers in synthetic organic and medicinal chemistry.
CAS Number | 4330-21-6 |
Molecular Formula | C21H21ClO5 |
Purity | ≥95% |
IUPAC Name | [(2R,3S,5R)-5-chloro-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
InChI | InChI=1S/C21H21ClO5/c1-13-3-7-15(8-4-13)20(23)25-12-18-17(11-19(22)26-18)27-21(24)16-9-5-14(2)6-10-16/h3-10,17-19H,11-12H2,1-2H3/t17-,18+,19-/m0/s1 |
InChIKey | FJHSYOMVMMNQJQ-OTWHNJEPSA-N |
SMILES | CC1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H](C[C@H](O2)Cl)OC(=O)C3=CC=C(C=C3)C |