For research use only. Not for therapeutic Use.
Homoarginine（Cat No.:M067802）, is an amino acid that shares structural similarities with arginine. It is a non-proteinogenic amino acid, meaning it is not commonly incorporated into proteins during translation. Homoarginine has been studied for its potential role in cardiovascular health, as it has been associated with improved endothelial function and reduced risk of cardiovascular diseases. Additionally, homoarginine has been investigated for its effects on nitric oxide synthesis and vascular health.
| Catalog Number | M067802 |
| CAS Number | 156-86-5 |
| Molecular Formula | C7H16N4O2 |
| Purity | ≥95% |
| Storage | 2-8°C |
| IUPAC Name | (2S)-2-amino-6-(diaminomethylideneamino)hexanoic acid |
| InChI | InChI=1S/C7H16N4O2/c8-5(6(12)13)3-1-2-4-11-7(9)10/h5H,1-4,8H2,(H,12,13)(H4,9,10,11)/t5-/m0/s1 |
| InChIKey | QUOGESRFPZDMMT-YFKPBYRVSA-N |
| SMILES | C(CCN=C(N)N)CC(C(=O)O)N |
