For research use only. Not for therapeutic Use.
Homogentisic acid is a phenolic acid and intermediate in the catabolism of aromatic amino acids, including phenylalanine and tyrosine. It is formed in excess during alkaptonuria, whereas excess deposition of homogentisic acid in connective tissues produces ochronosis.
| Catalog Number | R012115 |
| CAS Number | 451-13-8 |
| Synonyms | 2,5-Dihydroxybenzeneacetic Acid; 2,5-Dihydroxy-α-toluic Acid; 2,5-Dihydroxyphenylacetic Acid; Alcapton; Homogentisinic Acid; NSC 88940 |
| Molecular Formula | C8H8O4 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | -20°C |
| IUPAC Name | 2-(2,5-dihydroxyphenyl)acetic acid |
| InChI | InChI=1S/C8H8O4/c9-6-1-2-7(10)5(3-6)4-8(11)12/h1-3,9-10H,4H2,(H,11,12) |
| InChIKey | IGMNYECMUMZDDF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)CC(=O)O)O |
