For research use only. Not for therapeutic Use.
Homologous recombination-IN-1（Cat No.:I024177）is a small molecule inhibitor designed to disrupt the process of homologous recombination (HR), a critical mechanism for DNA repair. HR is involved in the repair of double-strand DNA breaks and is essential for maintaining genomic stability. By inhibiting this pathway, Homologous recombination-IN-1 has potential applications in cancer therapy, particularly for tumors with defects in DNA repair mechanisms. It may sensitize cancer cells to DNA-damaging agents such as chemotherapy or radiation therapy. Ongoing research is focused on optimizing its selectivity, efficacy, and therapeutic potential in combination with other cancer treatments.
| CAS Number | 391889-85-3 |
| Synonyms | 6-chloro-3-[3-(4-methoxyphenyl)-2-propanoyl-3,4-dihydropyrazol-5-yl]-4-phenyl-1H-quinolin-2-one |
| Molecular Formula | C28H24ClN3O3 |
| Purity | ≥95% |
| IUPAC Name | 6-chloro-3-[3-(4-methoxyphenyl)-2-propanoyl-3,4-dihydropyrazol-5-yl]-4-phenyl-1H-quinolin-2-one |
| InChI | InChI=1S/C28H24ClN3O3/c1-3-25(33)32-24(17-9-12-20(35-2)13-10-17)16-23(31-32)27-26(18-7-5-4-6-8-18)21-15-19(29)11-14-22(21)30-28(27)34/h4-15,24H,3,16H2,1-2H3,(H,30,34) |
| InChIKey | LAVOKBSCOSIGER-UHFFFAOYSA-N |
| SMILES | CCC(=O)N1C(CC(=N1)C2=C(C3=C(C=CC(=C3)Cl)NC2=O)C4=CC=CC=C4)C5=CC=C(C=C5)OC |
