For research use only. Not for therapeutic Use.
Homophthalic diacid (anhydride)(Cat No.:R070638, also known as homophthalic anhydride, is a cyclic anhydride derivative of homophthalic acid. It is widely used in organic synthesis as an intermediate for the preparation of various heterocyclic compounds, including isocoumarins and phthalides. The reactive anhydride group facilitates ring-opening reactions, making it valuable in the synthesis of complex molecular frameworks. Homophthalic anhydride is particularly important in pharmaceutical research for developing bioactive molecules and in materials science for producing polymers and resins. Its high reactivity and purity make it essential for advanced chemical research.
CAS Number | 89-51-0 |
Synonyms | 2-Carboxyphenylacetic acid |
Molecular Formula | C9H8O4 |
Purity | ≥95% |
IUPAC Name | 2-(carboxymethyl)benzoic acid |
InChI | InChI=1S/C9H8O4/c10-8(11)5-6-3-1-2-4-7(6)9(12)13/h1-4H,5H2,(H,10,11)(H,12,13) |
InChIKey | ZHQLTKAVLJKSKR-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)CC(=O)O)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |