For research use only. Not for therapeutic Use.
Homoveratryl chloride(CAT: M060626) is a high-purity organic compound characterized by a benzyl chloride functional group substituted with two methoxy groups on the aromatic ring. This compound is widely used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. Its well-defined structure and reactivity make it particularly valuable in the preparation of bioactive molecules, including enzyme inhibitors and receptor ligands. With excellent chemical stability and versatility, Homoveratryl chloride is an essential building block for researchers and manufacturers working on advanced organic synthesis and innovative chemical applications.
| Catalog Number | M060626 |
| CAS Number | 10313-60-7 |
| Molecular Formula | C10H11ClO3 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)acetyl chloride |
| InChI | InChI=1S/C10H11ClO3/c1-13-8-4-3-7(6-10(11)12)5-9(8)14-2/h3-5H,6H2,1-2H3 |
| InChIKey | QBJIMTPENIGDOG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CC(=O)Cl)OC |
