For research use only. Not for therapeutic Use.
HP590（Cat No.:I042708）is a small molecule compound that has shown potential in the treatment of various cancer types. It acts as an inhibitor of specific kinases involved in tumor growth, survival, and metastasis. By targeting key signaling pathways, HP590 disrupts the processes that allow cancer cells to proliferate and spread. It has demonstrated activity in preclinical studies against several cancers, including breast and lung cancer. Ongoing research aims to further evaluate its efficacy, safety, and potential as a targeted cancer therapy, with a focus on optimizing its pharmacological properties for clinical use.
| CAS Number | 2971855-37-3 |
| Synonyms | [4-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]piperazin-1-yl]-[4-[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]methanone |
| Molecular Formula | C29H24F6N4O3 |
| Purity | ≥95% |
| IUPAC Name | [4-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]piperazin-1-yl]-[4-[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]methanone |
| InChI | InChI=1S/C29H24F6N4O3/c30-28(31,32)18-41-24-11-1-19(2-12-24)17-38-13-15-39(16-14-38)27(40)22-5-3-21(4-6-22)26-36-25(37-42-26)20-7-9-23(10-8-20)29(33,34)35/h1-12H,13-18H2 |
| InChIKey | VFBJWQHKJOGQRX-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC2=CC=C(C=C2)OCC(F)(F)F)C(=O)C3=CC=C(C=C3)C4=NC(=NO4)C5=CC=C(C=C5)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
