For research use only. Not for therapeutic Use.
HPK1-IN-26（Cat No.:I043898）is a selective inhibitor of the HPK1 (hematopoietic progenitor kinase 1) enzyme, which plays a critical role in regulating immune cell signaling and activation. This peptide inhibitor is valuable for research in immunology, particularly in the study of immune response, inflammation, and autoimmune diseases. By targeting HPK1, HPK1-IN-26 helps modulate immune cell activation pathways, offering insights into potential therapeutic strategies for diseases related to immune system dysfunction. Its high specificity and potency make it a critical tool for understanding immune regulation and developing targeted treatments.
| CAS Number | 2229042-24-2 |
| Synonyms | 5-(2-piperidin-4-yl-1,3-thiazol-5-yl)-3-(pyridin-4-ylmethoxy)pyridin-2-amine |
| Molecular Formula | C19H21N5OS |
| Purity | ≥95% |
| IUPAC Name | 5-(2-piperidin-4-yl-1,3-thiazol-5-yl)-3-(pyridin-4-ylmethoxy)pyridin-2-amine |
| InChI | InChI=1S/C19H21N5OS/c20-18-16(25-12-13-1-5-21-6-2-13)9-15(10-23-18)17-11-24-19(26-17)14-3-7-22-8-4-14/h1-2,5-6,9-11,14,22H,3-4,7-8,12H2,(H2,20,23) |
| InChIKey | HSEGDFMLRPWOHH-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=NC=C(S2)C3=CC(=C(N=C3)N)OCC4=CC=NC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
