For research use only. Not for therapeutic Use.
HQL-79 (CAT: I011407) is indeed a selective inhibitor of hematopoietic prostaglandin D synthase (HPGDS). HPGDS is an enzyme involved in the synthesis of prostaglandin D2 (PGD2), which plays a role in various physiological and pathological processes, including inflammation and allergic responses. By inhibiting HPGDS, HQL-79 can modulate the production of PGD2 and potentially have anti-inflammatory and immunomodulatory effects. It has been studied for its potential therapeutic applications in inflammatory diseases such as asthma and allergic rhinitis.
| Catalog Number | I011407 |
| CAS Number | 162641-16-9 |
| Synonyms | 1-(3-(2H-tetrazol-5-yl)propyl)-4-(benzhydryloxy)piperidine |
| Molecular Formula | C22H27N5O |
| Purity | ≥95% |
| Target | PGE synthase |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | Store at RT |
| IUPAC Name | 4-benzhydryloxy-1-[3-(2H-tetrazol-5-yl)propyl]piperidine |
| InChI | InChI=1S/C22H27N5O/c1-3-8-18(9-4-1)22(19-10-5-2-6-11-19)28-20-13-16-27(17-14-20)15-7-12-21-23-25-26-24-21/h1-6,8-11,20,22H,7,12-17H2,(H,23,24,25,26) |
| InChIKey | TZQGXAHOROZEKN-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1OC(C2=CC=CC=C2)C3=CC=CC=C3)CCCC4=NNN=N4 |
| Reference | 1: Aritake K, Kado Y, Inoue T, Miyano M, Urade Y. Structural and functional 2: Matsushita N, Aritake K, Takada A, Hizue M, Hayashi K, Mitsui K, Hayashi M, <br> |
