For research use only. Not for therapeutic Use.
Hsp90-Cdc37-IN-3（Cat No.:I043878）is a selective inhibitor targeting the Hsp90-Cdc37 complex, a crucial molecular chaperone system involved in the stabilization and activation of client proteins, many of which are implicated in cancer and other diseases. By disrupting the interaction between Hsp90 and Cdc37, this inhibitor prevents the proper folding and function of oncoproteins, thereby inhibiting tumor growth. Hsp90-Cdc37-IN-3 is valuable in cancer research as it offers a potential strategy for targeting molecular chaperones to disrupt cancer cell survival and enhance the efficacy of other cancer treatments.
| CAS Number | 2361009-68-7 |
| Synonyms | 3-(2-chloro-4-nitroimidazol-1-yl)propyl (2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate |
| Molecular Formula | C35H44ClN3O6 |
| Purity | ≥95% |
| IUPAC Name | 3-(2-chloro-4-nitroimidazol-1-yl)propyl (2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate |
| InChI | InChI=1S/C35H44ClN3O6/c1-21-22-8-9-25-33(4,23(22)18-24(40)28(21)41)13-15-35(6)26-19-32(3,11-10-31(26,2)12-14-34(25,35)5)29(42)45-17-7-16-38-20-27(39(43)44)37-30(38)36/h8-9,18,20,26,41H,7,10-17,19H2,1-6H3/t26-,31-,32-,33+,34-,35+/m1/s1 |
| InChIKey | QHBZROOTFSFIMF-JVIXZCSZSA-N |
| SMILES | CC1=C(C(=O)C=C2C1=CC=C3[C@]2(CC[C@@]4([C@@]3(CC[C@@]5([C@H]4C[C@](CC5)(C)C(=O)OCCCN6C=C(N=C6Cl)[N+](=O)[O-])C)C)C)C)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
