For research use only. Not for therapeutic Use.
Hsp90-IN-17 (Example 5) hydrochloride is an HSP90 inhibitor that can be used in the study of proliferative diseases, such as cancer and neurodegenerative diseases[1].
| Catalog Number | I042644 |
| CAS Number | 1253584-63-2 |
| Synonyms | 5-[2,4-dihydroxy-6-(4-nitrophenoxy)phenyl]-N-piperidin-4-yl-1,2-oxazole-3-carboxamide;hydrochloride |
| Molecular Formula | C21H21ClN4O7 |
| Purity | ≥95% |
| InChI | InChI=1S/C21H20N4O7.ClH/c26-14-9-17(27)20(18(10-14)31-15-3-1-13(2-4-15)25(29)30)19-11-16(24-32-19)21(28)23-12-5-7-22-8-6-12;/h1-4,9-12,22,26-27H,5-8H2,(H,23,28);1H |
| InChIKey | KYYNVXMTLPAYQC-UHFFFAOYSA-N |
| SMILES | C1CNCCC1NC(=O)C2=NOC(=C2)C3=C(C=C(C=C3OC4=CC=C(C=C4)[N+](=O)[O-])O)O.Cl |
| Reference | [1]. Maria Gabriella Brasca, et al. Resorcinol derivatives as hsp90 inhibitors.WO2010121963. |
