For research use only. Not for therapeutic Use.
HTS07545（Cat No.:I043887）is a small molecule compound designed to target specific enzymes and pathways involved in cellular processes such as cell growth, survival, and apoptosis. It is primarily used in high-throughput screening (HTS) assays to identify potential drug candidates for various diseases, including cancer and inflammatory conditions. HTS07545 has shown promising activity in preclinical studies by modulating critical signaling pathways, making it an attractive lead compound for drug development. Its ability to selectively inhibit target proteins positions it as a valuable tool in biomedical research and therapeutic discovery.
| CAS Number | 118666-03-8 |
| Synonyms | ethyl 2-(3-cyano-4,6-diphenylpyridin-2-yl)oxyacetate |
| Molecular Formula | C22H18N2O3 |
| Purity | ≥95% |
| IUPAC Name | ethyl 2-(3-cyano-4,6-diphenylpyridin-2-yl)oxyacetate |
| InChI | InChI=1S/C22H18N2O3/c1-2-26-21(25)15-27-22-19(14-23)18(16-9-5-3-6-10-16)13-20(24-22)17-11-7-4-8-12-17/h3-13H,2,15H2,1H3 |
| InChIKey | PZNJITRXQKRPFY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COC1=C(C(=CC(=N1)C2=CC=CC=C2)C3=CC=CC=C3)C#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
