For research use only. Not for therapeutic Use.
HX 600 is a synthetic compound used extensively in pharmaceutical and biochemical research. Known for its role as a selective retinoic acid receptor (RAR) agonist, it is essential for studying cell differentiation, growth, and apoptosis. This compound’s high purity ensures reliable and consistent results in experimental procedures. Its applications extend to cancer research, dermatology, and the development of new therapeutic agents. HX 600 is a valuable tool in advanced medical research and drug discovery, contributing to innovative health solutions.
| Catalog Number | M042560 |
| CAS Number | 172705-89-4 |
| Synonyms | HX 600 |
| Molecular Formula | C29H30N2O2 |
| Purity | ≥95% |
| Target | Vitamin D Related/Nuclear Receptor |
| Storage | Desiccate at -20 ℃ |
| IUPAC Name | 4-(5,7,7,10,10-pentamethyl-8,9-dihydronaphtho[2,3-b][1,5]benzodiazepin-12-yl)benzoic acid |
| InChI | InChI=1S/C29H30N2O2/c1-28(2)14-15-29(3,4)22-17-25-20(16-21(22)28)26(18-10-12-19(13-11-18)27(32)33)30-23-8-6-7-9-24(23)31(25)5/h6-13,16-17H,14-15H2,1-5H3,(H,32,33) |
| InChIKey | DLFBCHSYAZBTSS-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=C3C(=C2)N(C4=CC=CC=C4N=C3C5=CC=C(C=C5)C(=O)O)C)(C)C)C |
