For research use only. Not for therapeutic Use.
Hydrazine Hydrate-d6 is a deuterated form of hydrazine hydrate, where all six hydrogen atoms in the hydrazine molecule are replaced with deuterium. This isotopically labeled compound is particularly valuable in chemical research and industrial applications, especially in studying reaction mechanisms, kinetic isotope effects, and deuterium labeling experiments. The deuterium labeling in Hydrazine Hydrate-d6 enhances stability and allows for precise tracking and analysis using techniques like mass spectrometry and NMR spectroscopy. It is commonly used in the synthesis of deuterated organic compounds, as well as in research focused on the behavior of hydrazine in various chemical processes, including its use as a reducing agent and in the production of pharmaceuticals and agricultural chemicals. This compound provides reliable and accurate data, supporting advanced research and development in chemistry and related fields.
CAS Number | 102096-80-0 |
Synonyms | Hydrazine-d4 Monodeuterate |
Molecular Formula | H6N2O |
Purity | ≥95% |
Storage | Room temperature |
IUPAC Name | deuterated water;1,1,2,2-tetradeuteriohydrazine |
InChI | InChI=1S/H4N2.H2O/c1-2;/h1-2H2;1H2/i/hD6 |
InChIKey | IKDUDTNKRLTJSI-YIKVAAQNSA-N |
SMILES | [2H]N([2H])N([2H])[2H].[2H]O[2H] |