Home
>
Chemical Reagents>Organic Building Blocks> Hydrazinecarboxamide, N,N'-(methylenedi-4,1-phenylene)bis[2,2-dimethyl-
For research use only. Not for therapeutic Use.
Hydrazinecarboxamide, N,N’-(methylenedi-4,1-phenylene)bis[2,2-dimethyl-] is a hydrazine derivative featuring two 2,2-dimethyl groups linked through a methylene bridge to a 4,1-phenylene structure. This compound exhibits interesting chemical properties due to the presence of hydrazine and amide functionalities, making it valuable in organic synthesis and medicinal chemistry. The hydrazine moiety can participate in various reactions, including condensation and oxidation, while the bulky dimethyl groups enhance steric hindrance. This compound may serve as a potential scaffold for developing pharmaceuticals and agrochemicals.
CAS Number | 85095-61-0 |
Molecular Formula | C19H26N6O2 |
Purity | ≥95% |
IUPAC Name | 1-(dimethylamino)-3-[4-[[4-(dimethylaminocarbamoylamino)phenyl]methyl]phenyl]urea |
InChI | InChI=1S/C19H26N6O2/c1-24(2)22-18(26)20-16-9-5-14(6-10-16)13-15-7-11-17(12-8-15)21-19(27)23-25(3)4/h5-12H,13H2,1-4H3,(H2,20,22,26)(H2,21,23,27) |
InChIKey | AQABZFKTYXFIJF-UHFFFAOYSA-N |
SMILES | CN(C)NC(=O)NC1=CC=C(C=C1)CC2=CC=C(C=C2)NC(=O)NN(C)C |