For research use only. Not for therapeutic Use.
Hydrazinoacetic acid (Cat.No:M061625) is a chemical compound known for its hydrazine-like properties. It contains both an amino group (NH2) and a carboxylic acid group (COOH). It has applications in organic synthesis and is used in the preparation of various pharmaceuticals and agrochemicals. Additionally, it’s studied for its potential biological activities.
| Catalog Number | M061625 |
| CAS Number | 14150-64-2 |
| Molecular Formula | C2H6N2O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-hydrazinylacetic acid |
| InChI | InChI=1S/C2H6N2O2/c3-4-1-2(5)6/h4H,1,3H2,(H,5,6) |
| InChIKey | RRBZUCWNYQUCTR-UHFFFAOYSA-N |
| SMILES | C(C(=O)O)NN |
